6(5H)-Phenanthridinone, 1-nitro- structure
|
Common Name | 6(5H)-Phenanthridinone, 1-nitro- | ||
|---|---|---|---|---|
| CAS Number | 26690-02-8 | Molecular Weight | 240.21400 | |
| Density | 1.409g/cm3 | Boiling Point | 340.8ºC at 760mmHg | |
| Molecular Formula | C13H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.9ºC | |
| Name | 1-nitro-5H-phenanthridin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.409g/cm3 |
|---|---|
| Boiling Point | 340.8ºC at 760mmHg |
| Molecular Formula | C13H8N2O3 |
| Molecular Weight | 240.21400 |
| Flash Point | 159.9ºC |
| Exact Mass | 240.05300 |
| PSA | 78.68000 |
| LogP | 3.11270 |
| Vapour Pressure | 8.42E-05mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | YNLNOOJGSMSZEY-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2cccc([N+](=O)[O-])c2c2ccccc12 |
|
~%
6(5H)-Phenanthr... CAS#:26690-02-8 |
| Literature: Caldwell; Walls Journal of the Chemical Society, 1952 , p. 2156,2161 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 6(5H)-Phenanthridinone,1-nitro |
| 1-nitrophenanthridin-6(5H)-one |
| 1-Nitro-6(5H)-phenanthridinon |