methyl 9-chlorophenanthrene-1-carboxylate structure
|
Common Name | methyl 9-chlorophenanthrene-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 26698-26-0 | Molecular Weight | 270.71000 | |
| Density | 1.304g/cm3 | Boiling Point | 434.7ºC at 760 mmHg | |
| Molecular Formula | C16H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236ºC | |
| Name | methyl 9-chlorophenanthrene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 434.7ºC at 760 mmHg |
| Molecular Formula | C16H11ClO2 |
| Molecular Weight | 270.71000 |
| Flash Point | 236ºC |
| Exact Mass | 270.04500 |
| PSA | 26.30000 |
| LogP | 4.43300 |
| Vapour Pressure | 9.29E-08mmHg at 25°C |
| Index of Refraction | 1.682 |
| InChIKey | DRMDQZSSUUEMOR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc2c1cc(Cl)c1ccccc12 |
|
~%
methyl 9-chloro... CAS#:26698-26-0 |
| Literature: Krbechek,L.O. et al. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 234 - 238 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Methyl 9-chloro-1-phenanthrenecarboxylate |