1,4-Naphthalenedione,4a,5,8,8a-tetrahydro-6,7-dimethyl- structure
|
Common Name | 1,4-Naphthalenedione,4a,5,8,8a-tetrahydro-6,7-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 2670-18-0 | Molecular Weight | 190.23800 | |
| Density | 1.093g/cm3 | Boiling Point | 312.9ºC at 760mmHg | |
| Molecular Formula | C12H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.1ºC | |
| Name | 6,7-dimethyl-5,8,9,10-tetrahydronapthoquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 312.9ºC at 760mmHg |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.23800 |
| Flash Point | 117.1ºC |
| Exact Mass | 190.09900 |
| PSA | 34.14000 |
| LogP | 2.05700 |
| Vapour Pressure | 0.000513mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | IQXXMOWPSFRMSL-UHFFFAOYSA-N |
| SMILES | CC1=C(C)CC2C(=O)C=CC(=O)C2C1 |
|
~95%
1,4-Naphthalene... CAS#:2670-18-0 |
| Literature: Zhu, Zuolin; Espenson, James H. Journal of the American Chemical Society, 1997 , vol. 119, # 15 p. 3507 - 3512 |
| 6,7-dimetil-4a,5,8,8a-tetrahidro-1,4-naftoquinona |
| 6,7-dimethyl-4a,5,8,8a-tetrahydronaphthalene-1,4-dione |
| 6,7-dimethyl-4a,5,8,8a-tetrahydro-1,4-naphthoquinone |
| 4a,5,8,8a-Tetrahydro-6,7-dimethyl-1,4-naphthochinon |
| 4a,5,8,8a-tetrahydro-6,7-dimethyl-1,4-naphthoquinone |
| 6,7-Dimethyl-5,8,9,10-tetrahydro-1,4-naphthochinon |