2-[decanoyl(methyl)amino]acetic acid structure
|
Common Name | 2-[decanoyl(methyl)amino]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2671-91-2 | Molecular Weight | 243.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[decanoyl(methyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H25NO3 |
|---|---|
| Molecular Weight | 243.34200 |
| Exact Mass | 243.18300 |
| PSA | 57.61000 |
| LogP | 2.67010 |
| InChIKey | LERPQJNGDVCXSI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)N(C)CC(=O)O |
|
~%
2-[decanoyl(met... CAS#:2671-91-2 |
| Literature: Jungermann et al. Journal of the American Chemical Society, 1956 , vol. 78, p. 172 |
|
~%
2-[decanoyl(met... CAS#:2671-91-2 |
| Literature: Iyer, Venkataraman N.; Sheth, Geeta N.; Subrahmanyam, V. V. R. Journal of the Indian Chemical Society, 1982 , vol. 59, # 7 p. 856 - 859 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Glycine,N-methyl-N-(1-oxodecyl) |
| UNII-ZVG45J8Q00 |
| Caproyl sarcosine |
| N-decanoyl-N-methyl-glycine |
| N-decanoylsarcosine |
| Sarcosine,N-decanoyl |
| N-Decanoyl-N-methyl-glycin |