(3R,4R)-4,5-ISOPROPYLIDENEPENT-2-EN-3-OL structure
|
Common Name | (3R,4R)-4,5-ISOPROPYLIDENEPENT-2-EN-3-OL | ||
|---|---|---|---|---|
| CAS Number | 267230-43-3 | Molecular Weight | 364.39300 | |
| Density | 1.28g/cm3 | Boiling Point | 550.3ºC at 760mmHg | |
| Molecular Formula | C18H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 286.6ºC | |
| Name | (3S,4R)-4-{[(Benzyloxy)carbonyl]amino}-1-{[(2-methyl-2-propanyl)o xy]carbonyl}-3-pyrrolidinecarboxylic acid |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 550.3ºC at 760mmHg |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.39300 |
| Flash Point | 286.6ºC |
| Exact Mass | 364.16300 |
| PSA | 108.66000 |
| LogP | 2.37520 |
| Vapour Pressure | 6.07E-13mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | TXZPPCRYQXSVCL-KBPBESRZSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(NC(=O)OCc2ccccc2)C(C(=O)O)C1 |
|
~%
(3R,4R)-4,5-ISO... CAS#:267230-43-3 |
| Literature: Wang, Xifang; Espinosa, Juan F.; Gellman, Samuel H. Journal of the American Chemical Society, 2000 , vol. 122, # 19 p. 4821 - 4822 |