[(E)-4-(hydroxymethylamino)-4-oxobut-2-en-2-yl] dimethyl phosphate
Modify Date: 2025-08-25 20:02:41
![[(E)-4-(hydroxymethylamino)-4-oxobut-2-en-2-yl] dimethyl phosphate Structure](https://image.chemsrc.com/caspic/213/2673-67-8.png)
[(E)-4-(hydroxymethylamino)-4-oxobut-2-en-2-yl] dimethyl phosphate structure
|
Common Name | [(E)-4-(hydroxymethylamino)-4-oxobut-2-en-2-yl] dimethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 2673-67-8 | Molecular Weight | 239.16300 | |
| Density | 1.298g/cm3 | Boiling Point | 368.2ºC at 760mmHg | |
| Molecular Formula | C7H14NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.5ºC | |
| Name | [(E)-4-(hydroxymethylamino)-4-oxobut-2-en-2-yl] dimethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 368.2ºC at 760mmHg |
| Molecular Formula | C7H14NO6P |
| Molecular Weight | 239.16300 |
| Flash Point | 176.5ºC |
| Exact Mass | 239.05600 |
| PSA | 107.39000 |
| LogP | 1.21400 |
| Vapour Pressure | 6.43E-07mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | QICWFXHLSZKZNU-GQCTYLIASA-N |
| SMILES | COP(=O)(OC)OC(C)=CC(=O)NCO |
| Crotonamide,3-hydroxy-N-(hydroxymethyl)-,dimethylphosphate,(E) |
| Phosphoric acid,3-(hydroxymethylamino)-1-methyl-3-oxo-1-propenyl dimethyl ester |
| Phosphoric acid,dimethyl ester,3-ester with 3-hydroxy-N-(hydroxymethyl)crotonamide,(E) |