1-(1,3-Benzodioxol-5-yl)piperidin-4-one structure
|
Common Name | 1-(1,3-Benzodioxol-5-yl)piperidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 267428-44-4 | Molecular Weight | 219.23700 | |
| Density | 1.294g/cm3 | Boiling Point | 411.9ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.9ºC | |
| Name | 1-(1,3-Benzodioxol-5-yl)piperidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.294g/cm3 |
|---|---|
| Boiling Point | 411.9ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 202.9ºC |
| Exact Mass | 219.09000 |
| PSA | 38.77000 |
| LogP | 1.64960 |
| Vapour Pressure | 5.41E-07mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | YUEKZMYUVRHVQM-UHFFFAOYSA-N |
| SMILES | O=C1CCN(c2ccc3c(c2)OCO3)CC1 |
| HS Code | 2934999090 |
|---|
|
~79%
1-(1,3-Benzodio... CAS#:267428-44-4 |
| Literature: Willemse; Piet; Warman; Hartl; Verhoeven; Brouwer Journal of the American Chemical Society, 2000 , vol. 122, # 15 p. 3721 - 3730 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(1,3-benzodioxol-5-yl)piperidin-4-one |