3-Buten-2-one,2-(2,4-dinitrophenyl)hydrazone structure
|
Common Name | 3-Buten-2-one,2-(2,4-dinitrophenyl)hydrazone | ||
|---|---|---|---|---|
| CAS Number | 2675-19-6 | Molecular Weight | 250.211 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 381.0±52.0 °C at 760 mmHg | |
| Molecular Formula | C10H10N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.2±30.7 °C | |
| Name | N-(but-3-en-2-ylideneamino)-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 381.0±52.0 °C at 760 mmHg |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.211 |
| Flash Point | 184.2±30.7 °C |
| Exact Mass | 250.070206 |
| PSA | 116.03000 |
| LogP | 2.86 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | JIPPLQKHXOGGSF-UHFFFAOYSA-N |
| SMILES | C=CC(C)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
|
~%
3-Buten-2-one,2... CAS#:2675-19-6 |
| Literature: Lou, Ji-Dong; Zhu, Long-Hua; Ma, Yi-Chun; Li, Li Synthetic Communications, 2006 , vol. 36, # 20 p. 3061 - 3064 |
|
~10%
3-Buten-2-one,2... CAS#:2675-19-6 |
| Literature: Shaffer, Christopher L.; Harriman, Shawn; Koen, Yakov M.; Hanzlik, Robert P. Journal of the American Chemical Society, 2002 , vol. 124, # 28 p. 8268 - 8274 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-Buten-2-one,(2,4-dinitrophenyl)hydrazone (6CI,7CI,8CI,9CI) |
| 3-Buten-2-on-2,4-Dinitrophenyl-hydrazon |
| But-3-en-2-on-(2,4-dinitro-phenylhydrazon) |
| N-(BUT-3-EN-2-YLIDENEAMINO)-2,4-DINITRO-ANILINE |
| Vinyl-methyl-keton-2,4-dinitrophenylhydrazon |
| methyl vinyl ketone (2,4-dinitrophenyl)hydrazone |
| 3-Buten-2-one,2-(2,4-dinitrophenyl)hydrazone |
| but-3-en-2-one-(2,4-dinitro-phenylhydrazone) |
| 3-Buten-2-one, 2-(2,4-dinitrophenyl)hydrazone |
| Methyl-vinyl-keton-(2,4-dinitrophenylhydrazon) |
| 1-(3-Buten-2-ylidene)-2-(2,4-dinitrophenyl)hydrazine |