4-[2-(1-phenylethylidene)hydrazinyl]benzoic acid structure
|
Common Name | 4-[2-(1-phenylethylidene)hydrazinyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2675-42-5 | Molecular Weight | 254.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(1-phenylethylidene)hydrazinyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2O2 |
|---|---|
| Molecular Weight | 254.28400 |
| Exact Mass | 254.10600 |
| PSA | 61.69000 |
| LogP | 3.29390 |
| InChIKey | MRGAGDMCVDFJLP-UHFFFAOYSA-N |
| SMILES | CC(=NNc1ccc(C(=O)O)cc1)c1ccccc1 |
| HS Code | 2928000090 |
|---|
|
~43%
4-[2-(1-phenyle... CAS#:2675-42-5 |
| Literature: Kissei Pharmaceutical Co., Ltd. Patent: EP1932833 A1, 2008 ; Location in patent: Page/Page column 5-6; 8 ; EP 1932833 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-(1-phenyl-ethylidenehydrazino)-benzoic acid |
| 4-(1-Phenyl-aethylidenhydrazino)-benzoesaeure |
| ACETOPHENONE 4-CARBOXYPHENYLHYDRAZONE |