1-isopropyl-1-(3-tolyl)urea structure
|
Common Name | 1-isopropyl-1-(3-tolyl)urea | ||
|---|---|---|---|---|
| CAS Number | 26772-92-9 | Molecular Weight | 192.25800 | |
| Density | 1.08g/cm3 | Boiling Point | 316.1ºC at 760mmHg | |
| Molecular Formula | C11H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.9ºC | |
| Name | 1-(3-methylphenyl)-1-propan-2-ylurea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 316.1ºC at 760mmHg |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.25800 |
| Flash Point | 144.9ºC |
| Exact Mass | 192.12600 |
| PSA | 47.32000 |
| LogP | 2.80230 |
| Vapour Pressure | 0.00042mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | BOPFLHYLIGVMGZ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(N(C(N)=O)C(C)C)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 247-997-0 |
| 1-Isopropyl-1-(3-tolyl)urea |
| 1-m-Tolyl-1-isopropylharnstoff |
| N-isopropyl-N-m-tolylurea |
| 1-Isopropyl-1-(m-tolyl)urea |
| Urea,1-isopropyl-1-(m-tolyl) |