3,5-Trifluromethylbenzoylacetonitrile structure
|
Common Name | 3,5-Trifluromethylbenzoylacetonitrile | ||
|---|---|---|---|---|
| CAS Number | 267880-81-9 | Molecular Weight | 281.15400 | |
| Density | 1.42g/cm3 | Boiling Point | 249.3ºC at 760mmHg | |
| Molecular Formula | C11H5F6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 104.6ºC | |
| Name | 3-[3,5-Bis(trifluoromethyl)phenyl]-3-oxopropanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 249.3ºC at 760mmHg |
| Molecular Formula | C11H5F6NO |
| Molecular Weight | 281.15400 |
| Flash Point | 104.6ºC |
| Exact Mass | 281.02800 |
| PSA | 40.86000 |
| LogP | 3.82058 |
| Vapour Pressure | 0.023mmHg at 25°C |
| Index of Refraction | 1.426 |
| InChIKey | GFZFAQOKWZGMQL-UHFFFAOYSA-N |
| SMILES | N#CCC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| HS Code | 2926909090 |
|---|
|
~76%
3,5-Trifluromet... CAS#:267880-81-9 |
| Literature: Indian Journal of Heterocyclic Chemistry, , vol. 21, # 1 p. 33 - 36 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3,5-Bis(Trifluoromethyl)Benzoylacetonitrile |
| PC9068 |