(2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid
Modify Date: 2025-08-27 17:24:27
![(2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid Structure](https://www.chemsrc.com/extcaspic/179/2679806-82-5.png)
(2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid structure
|
Common Name | (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2679806-82-5 | Molecular Weight | 305.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12FNO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12FNO6S |
|---|---|
| Molecular Weight | 305.28 |
| InChIKey | CPBKNNWBJFGLJQ-JTQLQIEISA-N |
| SMILES | CC(=O)NC(Cc1ccc(OS(=O)(=O)F)cc1)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid? |
| A: SMILES notation of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid is CC(=O)NC(Cc1ccc(OS(=O)(=O)F)cc1)C(=O)O. |
| Q: What is the Chinese name of 2679806-82-5? |
| A: Chinese name of 2679806-82-5 is 2679806-82-5. |
| Q: What is the molecular weight of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid? |
| A: Molecular weight of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid is 305.28. |
| Q: What is the English name of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid? |
| A: The English name of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid is (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid. |
| Q: What is the InChIKey of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid? |
| A: InChIKey of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid is CPBKNNWBJFGLJQ-JTQLQIEISA-N. |
| Q: What is the molecular formula of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid? |
| A: Molecular formula of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid is C11H12FNO6S. |
| Q: What is the CAS number of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid? |
| A: CAS number of (2S)-2-acetamido-3-{4-[(fluorosulfonyl)oxy]phenyl}propanoic acid is 2679806-82-5. |