rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate
Modify Date: 2025-09-17 01:18:04
rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate structure
|
Common Name | rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2679809-36-8 | Molecular Weight | 289.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H23NO3 |
|---|---|
| Molecular Weight | 289.4 |
| InChIKey | MFOAWAPCJWSUHT-ARFHVFGLSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCCC2CCC(O)CC21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2679809-36-8? |
| A: Chinese name of 2679809-36-8 is 2679809-36-8. |
| Q: What is the CAS number of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate? |
| A: CAS number of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate is 2679809-36-8. |
| Q: What is the molecular weight of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate? |
| A: Molecular weight of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate is 289.4. |
| Q: What is the molecular formula of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate? |
| A: Molecular formula of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate is C17H23NO3. |
| Q: What is the English name of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate? |
| A: The English name of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate is rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate. |
| Q: What is the SMILES notation of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate? |
| A: SMILES notation of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate is O=C(OCc1ccccc1)N1CCCC2CCC(O)CC21. |
| Q: What is the InChIKey of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate? |
| A: InChIKey of rac-benzyl (4aR,7S,8aS)-7-hydroxy-decahydroquinoline-1-carboxylate is MFOAWAPCJWSUHT-ARFHVFGLSA-N. |