(2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid
Modify Date: 2026-07-04 11:14:27
![(2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid Structure](https://www.chemsrc.com/extcaspic/330/2679930-07-3.png)
(2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid structure
|
Common Name | (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2679930-07-3 | Molecular Weight | 230.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18N2O4 |
|---|---|
| Molecular Weight | 230.26 |
| InChIKey | MZSFQBMGPREGPC-MRVPVSSYSA-N |
| SMILES | C=CCOC(=O)N(C)C(CCCN)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid? |
| A: CAS number of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid is 2679930-07-3. |
| Q: What is the English name of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid? |
| A: The English name of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid is (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid. |
| Q: What is the molecular formula of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid? |
| A: Molecular formula of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid is C10H18N2O4. |
| Q: What is the Chinese name of 2679930-07-3? |
| A: Chinese name of 2679930-07-3 is 2679930-07-3. |
| Q: What is the molecular weight of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid? |
| A: Molecular weight of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid is 230.26. |
| Q: What is the SMILES notation of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid? |
| A: SMILES notation of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid is C=CCOC(=O)N(C)C(CCCN)C(=O)O. |
| Q: What is the InChIKey of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid? |
| A: InChIKey of (2R)-5-amino-2-{methyl[(prop-2-en-1-yloxy)carbonyl]amino}pentanoic acid is MZSFQBMGPREGPC-MRVPVSSYSA-N. |