(4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid
Modify Date: 2025-09-06 01:06:35
(4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid structure
|
Common Name | (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2679939-84-3 | Molecular Weight | 229.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H10F3NO4 |
|---|---|
| Molecular Weight | 229.15 |
| InChIKey | NJRPYGAIWICORZ-BYPYZUCNSA-N |
| SMILES | O=C(O)CCC(CO)NC(=O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid? |
| A: SMILES notation of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid is O=C(O)CCC(CO)NC(=O)C(F)(F)F. |
| Q: What is the English name of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid? |
| A: The English name of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid is (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid. |
| Q: What is the Chinese name of 2679939-84-3? |
| A: Chinese name of 2679939-84-3 is 2679939-84-3. |
| Q: What is the InChIKey of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid? |
| A: InChIKey of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid is NJRPYGAIWICORZ-BYPYZUCNSA-N. |
| Q: What is the molecular formula of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid? |
| A: Molecular formula of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid is C7H10F3NO4. |
| Q: What is the CAS number of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid? |
| A: CAS number of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid is 2679939-84-3. |
| Q: What is the molecular weight of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid? |
| A: Molecular weight of (4S)-5-hydroxy-4-(2,2,2-trifluoroacetamido)pentanoic acid is 229.15. |