benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate
Modify Date: 2026-08-05 23:44:25
![benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate Structure](https://www.chemsrc.com/extcaspic/470/2679947-73-8.png)
benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate structure
|
Common Name | benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2679947-73-8 | Molecular Weight | 348.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21FN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21FN2O2S |
|---|---|
| Molecular Weight | 348.4 |
| InChIKey | MEZIGHZKYVVOCC-HOTGVXAUSA-N |
| SMILES | O=C(NCC1CC(F)CN1Cc1cccs1)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate? |
| A: Molecular formula of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate is C18H21FN2O2S. |
| Q: What is the molecular weight of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate? |
| A: Molecular weight of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate is 348.4. |
| Q: What is the CAS number of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate? |
| A: CAS number of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate is 2679947-73-8. |
| Q: What is the Chinese name of 2679947-73-8? |
| A: Chinese name of 2679947-73-8 is 2679947-73-8. |
| Q: What is the InChIKey of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate? |
| A: InChIKey of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate is MEZIGHZKYVVOCC-HOTGVXAUSA-N. |
| Q: What is the SMILES notation of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate? |
| A: SMILES notation of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate is O=C(NCC1CC(F)CN1Cc1cccs1)OCc1ccccc1. |
| Q: What is the English name of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate? |
| A: The English name of benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate is benzyl N-{[(2S,4S)-4-fluoro-1-[(thiophen-2-yl)methyl]pyrrolidin-2-yl]methyl}carbamate. |