6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid
Modify Date: 2026-08-03 21:54:18
![6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/418/2680561-08-2.png)
6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid structure
|
Common Name | 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2680561-08-2 | Molecular Weight | 342.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13F3N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13F3N2O4 |
|---|---|
| Molecular Weight | 342.27 |
| InChIKey | KOJRAWHXGVGAMW-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c3c(c2c1)CCN(C(=O)C(F)(F)F)C3C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid? |
| A: Molecular formula of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid is C15H13F3N2O4. |
| Q: What is the English name of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid? |
| A: The English name of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid is 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid. |
| Q: What is the CAS number of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid? |
| A: CAS number of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid is 2680561-08-2. |
| Q: What is the SMILES notation of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid? |
| A: SMILES notation of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid is COc1ccc2[nH]c3c(c2c1)CCN(C(=O)C(F)(F)F)C3C(=O)O. |
| Q: What is the molecular weight of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid? |
| A: Molecular weight of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid is 342.27. |
| Q: What is the Chinese name of 2680561-08-2? |
| A: Chinese name of 2680561-08-2 is 2680561-08-2. |
| Q: What is the InChIKey of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid? |
| A: InChIKey of 6-methoxy-2-(2,2,2-trifluoroacetyl)-1H,2H,3H,4H,9H-pyrido[3,4-b]indole-1-carboxylic acid is KOJRAWHXGVGAMW-UHFFFAOYSA-N. |