Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate structure
|
Common Name | Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 2680571-57-5 | Molecular Weight | 295.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9BrF2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9BrF2N2O2 |
|---|---|
| Molecular Weight | 295.08 |
| InChIKey | VVGUCJSVOOMMGO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(N)Cc1c(F)cnc(Br)c1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate? |
| A: SMILES notation of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate is COC(=O)C(N)Cc1c(F)cnc(Br)c1F. |
| Q: What is the CAS number of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate? |
| A: CAS number of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate is 2680571-57-5. |
| Q: What is the Chinese name of 2680571-57-5? |
| A: Chinese name of 2680571-57-5 is 2680571-57-5. |
| Q: What is the English name of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate? |
| A: The English name of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate is Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate. |
| Q: What is the InChIKey of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate? |
| A: InChIKey of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate is VVGUCJSVOOMMGO-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate? |
| A: Molecular formula of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate is C9H9BrF2N2O2. |
| Q: What is the molecular weight of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate? |
| A: Molecular weight of Methyl 2-amino-3-(2-bromo-3,5-difluoropyridin-4-yl)propanoate is 295.08. |