3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid
Modify Date: 2026-07-04 10:14:32
3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid structure
|
Common Name | 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 2680587-17-9 | Molecular Weight | 405.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F4INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H8F4INO3 |
|---|---|
| Molecular Weight | 405.08 |
| InChIKey | NISYXWCDYUGZPR-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Cc1cc(I)ccc1F)NC(=O)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid? |
| A: Molecular formula of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid is C11H8F4INO3. |
| Q: What is the molecular weight of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid? |
| A: Molecular weight of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid is 405.08. |
| Q: What is the InChIKey of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid? |
| A: InChIKey of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid is NISYXWCDYUGZPR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid? |
| A: SMILES notation of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid is O=C(O)C(Cc1cc(I)ccc1F)NC(=O)C(F)(F)F. |
| Q: What is the English name of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid? |
| A: The English name of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid is 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid. |
| Q: What is the CAS number of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid? |
| A: CAS number of 3-(2-Fluoro-5-iodophenyl)-2-(2,2,2-trifluoroacetamido)propanoic acid is 2680587-17-9. |
| Q: What is the Chinese name of 2680587-17-9? |
| A: Chinese name of 2680587-17-9 is 2680587-17-9. |