2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid
Modify Date: 2026-07-06 18:18:45
![2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid Structure](https://www.chemsrc.com/extcaspic/000/2680612-79-5.png)
2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid structure
|
Common Name | 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2680612-79-5 | Molecular Weight | 277.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO5 |
|---|---|
| Molecular Weight | 277.27 |
| InChIKey | WQNZFLOASGJPDN-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)NC(C(=O)O)c1ccc2c(c1)CCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: The English name of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid. |
| Q: What is the CAS number of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: CAS number of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is 2680612-79-5. |
| Q: What is the molecular formula of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: Molecular formula of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is C14H15NO5. |
| Q: What is the SMILES notation of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: SMILES notation of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is C=CCOC(=O)NC(C(=O)O)c1ccc2c(c1)CCO2. |
| Q: What is the Chinese name of 2680612-79-5? |
| A: Chinese name of 2680612-79-5 is 2680612-79-5. |
| Q: What is the InChIKey of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: InChIKey of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is WQNZFLOASGJPDN-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: Molecular weight of 2-(2,3-Dihydro-1-benzofuran-5-yl)-2-{[(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is 277.27. |