benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate
Modify Date: 2026-09-28 12:16:54
![benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate Structure](https://www.chemsrc.com/extcaspic/439/2680648-35-3.png)
benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate structure
|
Common Name | benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680648-35-3 | Molecular Weight | 251.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO4 |
|---|---|
| Molecular Weight | 251.28 |
| InChIKey | DOIPJKPVQGXUCG-UHFFFAOYSA-N |
| SMILES | O=C(NC1(C(O)CO)CC1)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate? |
| A: InChIKey of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate is DOIPJKPVQGXUCG-UHFFFAOYSA-N. |
| Q: What is the CAS number of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate? |
| A: CAS number of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate is 2680648-35-3. |
| Q: What is the Chinese name of 2680648-35-3? |
| A: Chinese name of 2680648-35-3 is 2680648-35-3. |
| Q: What is the English name of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate? |
| A: The English name of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate is benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate. |
| Q: What is the molecular formula of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate? |
| A: Molecular formula of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate is C13H17NO4. |
| Q: What is the molecular weight of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate? |
| A: Molecular weight of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate is 251.28. |
| Q: What is the SMILES notation of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate? |
| A: SMILES notation of benzyl N-[1-(1,2-dihydroxyethyl)cyclopropyl]carbamate is O=C(NC1(C(O)CO)CC1)OCc1ccccc1. |