tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate
Modify Date: 2025-09-17 11:03:27
tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate structure
|
Common Name | tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680663-52-7 | Molecular Weight | 201.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H16FNO2 |
|---|---|
| Molecular Weight | 201.24 |
| InChIKey | DHCJCSMQBDNLKA-UHFFFAOYSA-N |
| SMILES | C#CCN(CCF)C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate? |
| A: Molecular formula of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate is C10H16FNO2. |
| Q: What is the SMILES notation of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate? |
| A: SMILES notation of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate is C#CCN(CCF)C(=O)OC(C)(C)C. |
| Q: What is the CAS number of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate? |
| A: CAS number of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate is 2680663-52-7. |
| Q: What is the molecular weight of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate? |
| A: Molecular weight of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate is 201.24. |
| Q: What is the Chinese name of 2680663-52-7? |
| A: Chinese name of 2680663-52-7 is 2680663-52-7. |
| Q: What is the English name of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate? |
| A: The English name of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate is tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate. |
| Q: What is the InChIKey of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate? |
| A: InChIKey of tert-butyl N-(2-fluoroethyl)-N-(prop-2-yn-1-yl)carbamate is DHCJCSMQBDNLKA-UHFFFAOYSA-N. |