benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate
Modify Date: 2026-09-27 10:49:26
benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate structure
|
Common Name | benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680677-17-0 | Molecular Weight | 300.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H16N4O3 |
|---|---|
| Molecular Weight | 300.31 |
| InChIKey | IJQBGTTZGZAUHN-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cn(C2CN(C(=O)OCc3ccccc3)C2)nn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2680677-17-0? |
| A: Chinese name of 2680677-17-0 is 2680677-17-0. |
| Q: What is the CAS number of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate? |
| A: CAS number of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate is 2680677-17-0. |
| Q: What is the InChIKey of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate? |
| A: InChIKey of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate is IJQBGTTZGZAUHN-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate? |
| A: SMILES notation of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate is CC(=O)c1cn(C2CN(C(=O)OCc3ccccc3)C2)nn1. |
| Q: What is the English name of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate? |
| A: The English name of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate is benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate. |
| Q: What is the molecular formula of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate? |
| A: Molecular formula of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate is C15H16N4O3. |
| Q: What is the molecular weight of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate? |
| A: Molecular weight of benzyl 3-(4-acetyl-1H-1,2,3-triazol-1-yl)azetidine-1-carboxylate is 300.31. |