Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate
Modify Date: 2025-09-17 14:11:14
![Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate Structure](https://www.chemsrc.com/extcaspic/241/2680677-25-0.png)
Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate structure
|
Common Name | Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate | ||
|---|---|---|---|---|
| CAS Number | 2680677-25-0 | Molecular Weight | 388.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22BrNO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H22BrNO5 |
|---|---|
| Molecular Weight | 388.25 |
| InChIKey | PKJBOGWPYGJRHY-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(NC(=O)OC(C)(C)C)c1ccc(OC)c(Br)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: The English name of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate is Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate. |
| Q: What is the InChIKey of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: InChIKey of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate is PKJBOGWPYGJRHY-UHFFFAOYSA-N. |
| Q: What is the CAS number of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: CAS number of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate is 2680677-25-0. |
| Q: What is the molecular formula of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: Molecular formula of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate is C16H22BrNO5. |
| Q: What is the Chinese name of 2680677-25-0? |
| A: Chinese name of 2680677-25-0 is 2680677-25-0. |
| Q: What is the molecular weight of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: Molecular weight of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate is 388.25. |
| Q: What is the SMILES notation of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate? |
| A: SMILES notation of Methyl 3-(3-bromo-4-methoxyphenyl)-3-{[(tert-butoxy)carbonyl]amino}propanoate is COC(=O)CC(NC(=O)OC(C)(C)C)c1ccc(OC)c(Br)c1. |