benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate
Modify Date: 2026-07-17 19:16:47
![benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate Structure](https://www.chemsrc.com/extcaspic/323/2680680-53-7.png)
benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate structure
|
Common Name | benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680680-53-7 | Molecular Weight | 384.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H20N2O3 |
|---|---|
| Molecular Weight | 384.4 |
| InChIKey | FUZNINISHDBOFI-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N(Cc1cccc(O)c1)c1cccc2cccnc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate? |
| A: Molecular weight of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate is 384.4. |
| Q: What is the Chinese name of 2680680-53-7? |
| A: Chinese name of 2680680-53-7 is 2680680-53-7. |
| Q: What is the CAS number of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate? |
| A: CAS number of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate is 2680680-53-7. |
| Q: What is the English name of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate? |
| A: The English name of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate is benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate. |
| Q: What is the InChIKey of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate? |
| A: InChIKey of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate is FUZNINISHDBOFI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate? |
| A: Molecular formula of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate is C24H20N2O3. |
| Q: What is the SMILES notation of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate? |
| A: SMILES notation of benzyl N-[(3-hydroxyphenyl)methyl]-N-(quinolin-8-yl)carbamate is O=C(OCc1ccccc1)N(Cc1cccc(O)c1)c1cccc2cccnc12. |