2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid
Modify Date: 2026-09-20 11:39:10
![2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/285/2680680-54-8.png)
2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid structure
|
Common Name | 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2680680-54-8 | Molecular Weight | 348.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H20N2O4S |
|---|---|
| Molecular Weight | 348.4 |
| InChIKey | CGCUQGXNDWMZBI-UHFFFAOYSA-N |
| SMILES | Cc1sc(N(Cc2ccccc2)C(=O)OC(C)(C)C)nc1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid? |
| A: InChIKey of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid is CGCUQGXNDWMZBI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2680680-54-8? |
| A: Chinese name of 2680680-54-8 is 2680680-54-8. |
| Q: What is the SMILES notation of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid? |
| A: SMILES notation of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid is Cc1sc(N(Cc2ccccc2)C(=O)OC(C)(C)C)nc1C(=O)O. |
| Q: What is the English name of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid? |
| A: The English name of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid is 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid. |
| Q: What is the CAS number of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid? |
| A: CAS number of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid is 2680680-54-8. |
| Q: What is the molecular weight of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid? |
| A: Molecular weight of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid is 348.4. |
| Q: What is the molecular formula of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid? |
| A: Molecular formula of 2-{Benzyl[(tert-butoxy)carbonyl]amino}-5-methyl-1,3-thiazole-4-carboxylic acid is C17H20N2O4S. |