tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate
Modify Date: 2026-09-25 20:25:37
![tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate Structure](https://www.chemsrc.com/extcaspic/247/2680680-55-9.png)
tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate structure
|
Common Name | tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680680-55-9 | Molecular Weight | 305.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H15N5O4 |
|---|---|
| Molecular Weight | 305.29 |
| InChIKey | WEOVLCNGTHDQRJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1n[nH]c(-c2ccc([N+](=O)[O-])cc2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate? |
| A: Molecular weight of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate is 305.29. |
| Q: What is the molecular formula of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate? |
| A: Molecular formula of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate is C13H15N5O4. |
| Q: What is the CAS number of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate? |
| A: CAS number of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate is 2680680-55-9. |
| Q: What is the InChIKey of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate? |
| A: InChIKey of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate is WEOVLCNGTHDQRJ-UHFFFAOYSA-N. |
| Q: What is the English name of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate? |
| A: The English name of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate is tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate. |
| Q: What is the Chinese name of 2680680-55-9? |
| A: Chinese name of 2680680-55-9 is 2680680-55-9. |
| Q: What is the SMILES notation of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate? |
| A: SMILES notation of tert-butyl N-[3-(4-nitrophenyl)-1H-1,2,4-triazol-5-yl]carbamate is CC(C)(C)OC(=O)Nc1n[nH]c(-c2ccc([N+](=O)[O-])cc2)n1. |