benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate structure
|
Common Name | benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680680-64-0 | Molecular Weight | 404.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H24N2O5S |
|---|---|
| Molecular Weight | 404.5 |
| InChIKey | BIMLJZCOWFKQLO-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCC(CO)CC2)c1)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate? |
| A: Molecular formula of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate is C20H24N2O5S. |
| Q: What is the Chinese name of 2680680-64-0? |
| A: Chinese name of 2680680-64-0 is 2680680-64-0. |
| Q: What is the InChIKey of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate? |
| A: InChIKey of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate is BIMLJZCOWFKQLO-UHFFFAOYSA-N. |
| Q: What is the English name of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate? |
| A: The English name of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate is benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate. |
| Q: What is the molecular weight of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate? |
| A: Molecular weight of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate is 404.5. |
| Q: What is the SMILES notation of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate? |
| A: SMILES notation of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate is O=C(Nc1cccc(S(=O)(=O)N2CCC(CO)CC2)c1)OCc1ccccc1. |
| Q: What is the CAS number of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate? |
| A: CAS number of benzyl N-(3-{[4-(hydroxymethyl)piperidin-1-yl]sulfonyl}phenyl)carbamate is 2680680-64-0. |