benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate
Modify Date: 2025-09-28 20:44:58
benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate structure
|
Common Name | benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680681-01-8 | Molecular Weight | 398.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18BrF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H18BrF2NO2 |
|---|---|
| Molecular Weight | 398.2 |
| InChIKey | LPLSWNSYNDFZFG-UHFFFAOYSA-N |
| SMILES | Cc1cc(Br)cc(C)c1N(CC(F)F)C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate? |
| A: CAS number of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate is 2680681-01-8. |
| Q: What is the InChIKey of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate? |
| A: InChIKey of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate is LPLSWNSYNDFZFG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate? |
| A: Molecular weight of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate is 398.2. |
| Q: What is the molecular formula of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate? |
| A: Molecular formula of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate is C18H18BrF2NO2. |
| Q: What is the SMILES notation of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate? |
| A: SMILES notation of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate is Cc1cc(Br)cc(C)c1N(CC(F)F)C(=O)OCc1ccccc1. |
| Q: What is the Chinese name of 2680681-01-8? |
| A: Chinese name of 2680681-01-8 is 2680681-01-8. |
| Q: What is the English name of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate? |
| A: The English name of benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate is benzyl N-(4-bromo-2,6-dimethylphenyl)-N-(2,2-difluoroethyl)carbamate. |