benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate
Modify Date: 2025-09-17 09:08:02
![benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate Structure](https://www.chemsrc.com/extcaspic/436/2680681-05-2.png)
benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate structure
|
Common Name | benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680681-05-2 | Molecular Weight | 341.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15F4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H15F4NO2 |
|---|---|
| Molecular Weight | 341.30 |
| InChIKey | LJXMBIXPBDWUPT-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccc(C(F)C(F)(F)F)cc1)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate? |
| A: Molecular formula of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate is C17H15F4NO2. |
| Q: What is the CAS number of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate? |
| A: CAS number of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate is 2680681-05-2. |
| Q: What is the Chinese name of 2680681-05-2? |
| A: Chinese name of 2680681-05-2 is 2680681-05-2. |
| Q: What is the English name of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate? |
| A: The English name of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate is benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate. |
| Q: What is the molecular weight of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate? |
| A: Molecular weight of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate is 341.30. |
| Q: What is the SMILES notation of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate? |
| A: SMILES notation of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate is O=C(NCc1ccc(C(F)C(F)(F)F)cc1)OCc1ccccc1. |
| Q: What is the InChIKey of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate? |
| A: InChIKey of benzyl N-{[4-(1,2,2,2-tetrafluoroethyl)phenyl]methyl}carbamate is LJXMBIXPBDWUPT-UHFFFAOYSA-N. |