tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate
Modify Date: 2025-09-17 12:06:15
![tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate Structure](https://www.chemsrc.com/extcaspic/359/2680691-43-2.png)
tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate structure
|
Common Name | tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 2680691-43-2 | Molecular Weight | 342.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H24BrNO2 |
|---|---|
| Molecular Weight | 342.27 |
| InChIKey | TXWMIGXYQDIFNB-UHFFFAOYSA-N |
| SMILES | CCN(CC(C)c1cccc(Br)c1)C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate? |
| A: Molecular weight of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate is 342.27. |
| Q: What is the SMILES notation of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate? |
| A: SMILES notation of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate is CCN(CC(C)c1cccc(Br)c1)C(=O)OC(C)(C)C. |
| Q: What is the InChIKey of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate? |
| A: InChIKey of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate is TXWMIGXYQDIFNB-UHFFFAOYSA-N. |
| Q: What is the CAS number of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate? |
| A: CAS number of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate is 2680691-43-2. |
| Q: What is the molecular formula of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate? |
| A: Molecular formula of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate is C16H24BrNO2. |
| Q: What is the English name of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate? |
| A: The English name of tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate is tert-butyl N-[2-(3-bromophenyl)propyl]-N-ethylcarbamate. |
| Q: What is the Chinese name of 2680691-43-2? |
| A: Chinese name of 2680691-43-2 is 2680691-43-2. |