2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid
Modify Date: 2025-10-08 18:31:22
![2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid Structure](https://www.chemsrc.com/extcaspic/050/2680707-80-4.png)
2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid structure
|
Common Name | 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2680707-80-4 | Molecular Weight | 275.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12F3NO3 |
|---|---|
| Molecular Weight | 275.22 |
| InChIKey | FTQWRLMJWSBCOH-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc(CCNC(=O)C(F)(F)F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid? |
| A: Molecular formula of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid is C12H12F3NO3. |
| Q: What is the SMILES notation of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid? |
| A: SMILES notation of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid is O=C(O)Cc1cccc(CCNC(=O)C(F)(F)F)c1. |
| Q: What is the InChIKey of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid? |
| A: InChIKey of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid is FTQWRLMJWSBCOH-UHFFFAOYSA-N. |
| Q: What is the English name of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid? |
| A: The English name of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid is 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid. |
| Q: What is the molecular weight of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid? |
| A: Molecular weight of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid is 275.22. |
| Q: What is the Chinese name of 2680707-80-4? |
| A: Chinese name of 2680707-80-4 is 2680707-80-4. |
| Q: What is the CAS number of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid? |
| A: CAS number of 2-{3-[2-(2,2,2-Trifluoroacetamido)ethyl]phenyl}acetic acid is 2680707-80-4. |