Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate
Modify Date: 2025-09-17 10:13:36
Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate structure
|
Common Name | Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680714-41-2 | Molecular Weight | 300.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H16N2O4 |
|---|---|
| Molecular Weight | 300.31 |
| InChIKey | LBAOTHMZILKAJG-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCCc2c(O)cc(=O)[nH]c21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate? |
| A: CAS number of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate is 2680714-41-2. |
| Q: What is the molecular formula of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate? |
| A: Molecular formula of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate is C16H16N2O4. |
| Q: What is the Chinese name of 2680714-41-2? |
| A: Chinese name of 2680714-41-2 is 2680714-41-2. |
| Q: What is the English name of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate? |
| A: The English name of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate is Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate. |
| Q: What is the SMILES notation of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate? |
| A: SMILES notation of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate is O=C(OCc1ccccc1)N1CCCc2c(O)cc(=O)[nH]c21. |
| Q: What is the InChIKey of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate? |
| A: InChIKey of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate is LBAOTHMZILKAJG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate? |
| A: Molecular weight of Benzyl 5,7-dihydroxy-1,2,3,4-tetrahydro-1,8-naphthyridine-1-carboxylate is 300.31. |