2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid
Modify Date: 2026-08-06 14:35:04
![2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid Structure](https://www.chemsrc.com/extcaspic/018/2680717-90-0.png)
2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid structure
|
Common Name | 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2680717-90-0 | Molecular Weight | 285.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13F2NO4 |
|---|---|
| Molecular Weight | 285.24 |
| InChIKey | LYMSLGCFCIEQQP-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)N(CC(=O)O)Cc1ccc(F)c(F)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: CAS number of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is 2680717-90-0. |
| Q: What is the Chinese name of 2680717-90-0? |
| A: Chinese name of 2680717-90-0 is 2680717-90-0. |
| Q: What is the molecular weight of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: Molecular weight of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is 285.24. |
| Q: What is the molecular formula of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: Molecular formula of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is C13H13F2NO4. |
| Q: What is the SMILES notation of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: SMILES notation of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is C=CCOC(=O)N(CC(=O)O)Cc1ccc(F)c(F)c1. |
| Q: What is the InChIKey of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: InChIKey of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is LYMSLGCFCIEQQP-UHFFFAOYSA-N. |
| Q: What is the English name of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid? |
| A: The English name of 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid is 2-{[(3,4-Difluorophenyl)methyl][(prop-2-en-1-yloxy)carbonyl]amino}acetic acid. |