benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate
Modify Date: 2026-08-03 17:35:14
![benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate Structure](https://www.chemsrc.com/extcaspic/139/2680722-98-7.png)
benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate structure
|
Common Name | benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680722-98-7 | Molecular Weight | 333.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13BrN2O2 |
|---|---|
| Molecular Weight | 333.18 |
| InChIKey | AKCJQBXRJZLJCS-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCc2cnc(Br)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate? |
| A: The English name of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate is benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate. |
| Q: What is the molecular formula of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate? |
| A: Molecular formula of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate is C15H13BrN2O2. |
| Q: What is the SMILES notation of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate? |
| A: SMILES notation of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate is O=C(OCc1ccccc1)N1CCc2cnc(Br)cc21. |
| Q: What is the molecular weight of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate? |
| A: Molecular weight of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate is 333.18. |
| Q: What is the CAS number of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate? |
| A: CAS number of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate is 2680722-98-7. |
| Q: What is the Chinese name of 2680722-98-7? |
| A: Chinese name of 2680722-98-7 is 2680722-98-7. |
| Q: What is the InChIKey of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate? |
| A: InChIKey of benzyl 6-bromo-1H,2H,3H-pyrrolo[3,2-c]pyridine-1-carboxylate is AKCJQBXRJZLJCS-UHFFFAOYSA-N. |