benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate
Modify Date: 2025-11-10 17:54:41
![benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate Structure](https://www.chemsrc.com/extcaspic/290/2680723-27-5.png)
benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate structure
|
Common Name | benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680723-27-5 | Molecular Weight | 299.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H21NO3 |
|---|---|
| Molecular Weight | 299.4 |
| InChIKey | NIQUGXARBJPINH-UHFFFAOYSA-N |
| SMILES | C#CC1(NC(=O)OCc2ccccc2)CC2(CCOCC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate? |
| A: SMILES notation of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate is C#CC1(NC(=O)OCc2ccccc2)CC2(CCOCC2)C1. |
| Q: What is the InChIKey of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate? |
| A: InChIKey of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate is NIQUGXARBJPINH-UHFFFAOYSA-N. |
| Q: What is the English name of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate? |
| A: The English name of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate is benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate. |
| Q: What is the Chinese name of 2680723-27-5? |
| A: Chinese name of 2680723-27-5 is 2680723-27-5. |
| Q: What is the molecular weight of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate? |
| A: Molecular weight of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate is 299.4. |
| Q: What is the CAS number of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate? |
| A: CAS number of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate is 2680723-27-5. |
| Q: What is the molecular formula of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate? |
| A: Molecular formula of benzyl N-{2-ethynyl-7-oxaspiro[3.5]nonan-2-yl}carbamate is C18H21NO3. |