ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate
Modify Date: 2025-09-17 09:03:03
![ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate Structure](https://www.chemsrc.com/extcaspic/328/2680723-48-0.png)
ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate structure
|
Common Name | ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680723-48-0 | Molecular Weight | 334.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16BrN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H16BrN3O4 |
|---|---|
| Molecular Weight | 334.17 |
| InChIKey | JSZUFRNGKDFFLN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1nc(NC(=O)OC(C)(C)C)[nH]c1Br |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate? |
| A: SMILES notation of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate is CCOC(=O)c1nc(NC(=O)OC(C)(C)C)[nH]c1Br. |
| Q: What is the InChIKey of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate? |
| A: InChIKey of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate is JSZUFRNGKDFFLN-UHFFFAOYSA-N. |
| Q: What is the CAS number of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate? |
| A: CAS number of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate is 2680723-48-0. |
| Q: What is the English name of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate? |
| A: The English name of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate is ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate. |
| Q: What is the Chinese name of 2680723-48-0? |
| A: Chinese name of 2680723-48-0 is 2680723-48-0. |
| Q: What is the molecular weight of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate? |
| A: Molecular weight of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate is 334.17. |
| Q: What is the molecular formula of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate? |
| A: Molecular formula of ethyl 4-bromo-2-{[(tert-butoxy)carbonyl]amino}-1H-imidazole-5-carboxylate is C11H16BrN3O4. |