prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate
Modify Date: 2025-08-27 17:18:57
![prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate Structure](https://www.chemsrc.com/extcaspic/414/2680723-68-4.png)
prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate structure
|
Common Name | prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680723-68-4 | Molecular Weight | 350.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H26N2O5 |
|---|---|
| Molecular Weight | 350.4 |
| InChIKey | KRTBMXAAXUIGMT-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)N(CC(O)COc1ccc(NC(C)=O)cc1)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate? |
| A: The English name of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate is prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate. |
| Q: What is the InChIKey of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate? |
| A: InChIKey of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate is KRTBMXAAXUIGMT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate? |
| A: Molecular formula of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate is C18H26N2O5. |
| Q: What is the Chinese name of 2680723-68-4? |
| A: Chinese name of 2680723-68-4 is 2680723-68-4. |
| Q: What is the SMILES notation of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate? |
| A: SMILES notation of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate is C=CCOC(=O)N(CC(O)COc1ccc(NC(C)=O)cc1)C(C)C. |
| Q: What is the CAS number of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate? |
| A: CAS number of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate is 2680723-68-4. |
| Q: What is the molecular weight of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate? |
| A: Molecular weight of prop-2-en-1-yl N-[3-(4-acetamidophenoxy)-2-hydroxypropyl]-N-(propan-2-yl)carbamate is 350.4. |