Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate
Modify Date: 2025-09-28 13:21:27
![Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate Structure](https://www.chemsrc.com/extcaspic/407/2680723-95-7.png)
Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate structure
|
Common Name | Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680723-95-7 | Molecular Weight | 397.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H27N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H27N3O5S |
|---|---|
| Molecular Weight | 397.5 |
| InChIKey | AOHAKEDGYCWTPS-UHFFFAOYSA-N |
| SMILES | CC1CN(S(=O)(=O)N2CCN(C(=O)OCc3ccccc3)CC2)CC(C)O1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate? |
| A: Molecular weight of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate is 397.5. |
| Q: What is the molecular formula of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate? |
| A: Molecular formula of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate is C18H27N3O5S. |
| Q: What is the English name of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate? |
| A: The English name of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate is Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate. |
| Q: What is the SMILES notation of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate? |
| A: SMILES notation of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate is CC1CN(S(=O)(=O)N2CCN(C(=O)OCc3ccccc3)CC2)CC(C)O1. |
| Q: What is the Chinese name of 2680723-95-7? |
| A: Chinese name of 2680723-95-7 is 2680723-95-7. |
| Q: What is the CAS number of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate? |
| A: CAS number of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate is 2680723-95-7. |
| Q: What is the InChIKey of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate? |
| A: InChIKey of Benzyl 4-[(2,6-dimethylmorpholin-4-yl)sulfonyl]piperazine-1-carboxylate is AOHAKEDGYCWTPS-UHFFFAOYSA-N. |