benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate
Modify Date: 2026-09-28 13:28:17
![benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate Structure](https://www.chemsrc.com/extcaspic/006/2680743-01-3.png)
benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate structure
|
Common Name | benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 2680743-01-3 | Molecular Weight | 347.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H17N3O3 |
|---|---|
| Molecular Weight | 347.4 |
| InChIKey | UMFWHAVVUKNYKL-UHFFFAOYSA-N |
| SMILES | CN(Cc1coc(-c2ccc(C#N)cc2)n1)C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate? |
| A: The English name of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate is benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate. |
| Q: What is the molecular formula of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate? |
| A: Molecular formula of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate is C20H17N3O3. |
| Q: What is the SMILES notation of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate? |
| A: SMILES notation of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate is CN(Cc1coc(-c2ccc(C#N)cc2)n1)C(=O)OCc1ccccc1. |
| Q: What is the CAS number of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate? |
| A: CAS number of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate is 2680743-01-3. |
| Q: What is the InChIKey of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate? |
| A: InChIKey of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate is UMFWHAVVUKNYKL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate? |
| A: Molecular weight of benzyl N-{[2-(4-cyanophenyl)-1,3-oxazol-4-yl]methyl}-N-methylcarbamate is 347.4. |
| Q: What is the Chinese name of 2680743-01-3? |
| A: Chinese name of 2680743-01-3 is 2680743-01-3. |