(9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate
Modify Date: 2026-09-27 11:36:08
(9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate structure
|
Common Name | (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680757-31-5 | Molecular Weight | 404.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C25H28N2O3 |
|---|---|
| Molecular Weight | 404.5 |
| InChIKey | NQULZRWPSGNOBS-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(O)(C#N)CC(C)(C)N1C(=O)OCC1c2ccccc2-c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate? |
| A: The English name of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate is (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate. |
| Q: What is the molecular formula of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate? |
| A: Molecular formula of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate is C25H28N2O3. |
| Q: What is the SMILES notation of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate? |
| A: SMILES notation of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate is CC1(C)CC(O)(C#N)CC(C)(C)N1C(=O)OCC1c2ccccc2-c2ccccc21. |
| Q: What is the InChIKey of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate? |
| A: InChIKey of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate is NQULZRWPSGNOBS-UHFFFAOYSA-N. |
| Q: What is the CAS number of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate? |
| A: CAS number of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate is 2680757-31-5. |
| Q: What is the Chinese name of 2680757-31-5? |
| A: Chinese name of 2680757-31-5 is 2680757-31-5. |
| Q: What is the molecular weight of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate? |
| A: Molecular weight of (9H-fluoren-9-yl)methyl 4-cyano-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxylate is 404.5. |