Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate
Modify Date: 2026-07-17 11:21:20
Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate structure
|
Common Name | Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680764-58-1 | Molecular Weight | 294.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23FN2O2 |
|---|---|
| Molecular Weight | 294.36 |
| InChIKey | SOCWNXLKLPJHCS-UHFFFAOYSA-N |
| SMILES | CC1(C)CN(CCF)CCN1C(=O)OCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2680764-58-1? |
| A: Chinese name of 2680764-58-1 is 2680764-58-1. |
| Q: What is the CAS number of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate? |
| A: CAS number of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate is 2680764-58-1. |
| Q: What is the molecular weight of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate? |
| A: Molecular weight of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate is 294.36. |
| Q: What is the SMILES notation of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate? |
| A: SMILES notation of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate is CC1(C)CN(CCF)CCN1C(=O)OCc1ccccc1. |
| Q: What is the English name of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate? |
| A: The English name of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate is Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate. |
| Q: What is the molecular formula of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate? |
| A: Molecular formula of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate is C16H23FN2O2. |
| Q: What is the InChIKey of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate? |
| A: InChIKey of Benzyl 4-(2-fluoroethyl)-2,2-dimethylpiperazine-1-carboxylate is SOCWNXLKLPJHCS-UHFFFAOYSA-N. |