3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid
Modify Date: 2026-09-15 06:59:09
![3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid Structure](https://www.chemsrc.com/extcaspic/053/2680765-75-5.png)
3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid structure
|
Common Name | 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid | ||
|---|---|---|---|---|
| CAS Number | 2680765-75-5 | Molecular Weight | 251.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO4 |
|---|---|
| Molecular Weight | 251.28 |
| InChIKey | WFCNCJKVCKUBCN-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)NC1CCC(C#CC(=O)O)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid? |
| A: Molecular weight of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid is 251.28. |
| Q: What is the InChIKey of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid? |
| A: InChIKey of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid is WFCNCJKVCKUBCN-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2680765-75-5? |
| A: Chinese name of 2680765-75-5 is 2680765-75-5. |
| Q: What is the molecular formula of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid? |
| A: Molecular formula of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid is C13H17NO4. |
| Q: What is the CAS number of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid? |
| A: CAS number of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid is 2680765-75-5. |
| Q: What is the SMILES notation of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid? |
| A: SMILES notation of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid is C=CCOC(=O)NC1CCC(C#CC(=O)O)CC1. |
| Q: What is the English name of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid? |
| A: The English name of 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid is 3-(4-{[(Prop-2-en-1-yloxy)carbonyl]amino}cyclohexyl)prop-2-ynoic acid. |