(9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate
Modify Date: 2026-07-15 08:44:14
(9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate structure
|
Common Name | (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680771-41-7 | Molecular Weight | 341.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20FNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20FNO3 |
|---|---|
| Molecular Weight | 341.4 |
| InChIKey | HZRLYUWQHHCLCZ-UHFFFAOYSA-N |
| SMILES | O=C(OCC1c2ccccc2-c2ccccc21)N1CC(OCCF)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate? |
| A: Molecular formula of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate is C20H20FNO3. |
| Q: What is the CAS number of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate? |
| A: CAS number of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate is 2680771-41-7. |
| Q: What is the English name of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate? |
| A: The English name of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate is (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate. |
| Q: What is the Chinese name of 2680771-41-7? |
| A: Chinese name of 2680771-41-7 is 2680771-41-7. |
| Q: What is the InChIKey of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate? |
| A: InChIKey of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate is HZRLYUWQHHCLCZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate? |
| A: SMILES notation of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate is O=C(OCC1c2ccccc2-c2ccccc21)N1CC(OCCF)C1. |
| Q: What is the molecular weight of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate? |
| A: Molecular weight of (9H-fluoren-9-yl)methyl 3-(2-fluoroethoxy)azetidine-1-carboxylate is 341.4. |