Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate
Modify Date: 2025-11-06 20:37:03
Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate structure
|
Common Name | Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680800-28-4 | Molecular Weight | 340.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H20N2O4 |
|---|---|
| Molecular Weight | 340.4 |
| InChIKey | MCLLURFYQSUAGK-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1CCCC(c2ccc([N+](=O)[O-])cc2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate? |
| A: The English name of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate is Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate. |
| Q: What is the SMILES notation of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate? |
| A: SMILES notation of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate is O=C(OCc1ccccc1)N1CCCC(c2ccc([N+](=O)[O-])cc2)C1. |
| Q: What is the molecular formula of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate? |
| A: Molecular formula of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate is C19H20N2O4. |
| Q: What is the Chinese name of 2680800-28-4? |
| A: Chinese name of 2680800-28-4 is 2680800-28-4. |
| Q: What is the InChIKey of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate? |
| A: InChIKey of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate is MCLLURFYQSUAGK-UHFFFAOYSA-N. |
| Q: What is the CAS number of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate? |
| A: CAS number of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate is 2680800-28-4. |
| Q: What is the molecular weight of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate? |
| A: Molecular weight of Benzyl 3-(4-nitrophenyl)piperidine-1-carboxylate is 340.4. |