benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate
Modify Date: 2025-09-17 16:34:13
benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate structure
|
Common Name | benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 2680800-69-3 | Molecular Weight | 341.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19NO5 |
|---|---|
| Molecular Weight | 341.4 |
| InChIKey | RLEVZOWNSIJISJ-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)c2c(c1)C(NC(=O)OCc1ccccc1)CC2=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate? |
| A: Molecular formula of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate is C19H19NO5. |
| Q: What is the Chinese name of 2680800-69-3? |
| A: Chinese name of 2680800-69-3 is 2680800-69-3. |
| Q: What is the SMILES notation of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate? |
| A: SMILES notation of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate is COc1cc(OC)c2c(c1)C(NC(=O)OCc1ccccc1)CC2=O. |
| Q: What is the InChIKey of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate? |
| A: InChIKey of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate is RLEVZOWNSIJISJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate? |
| A: Molecular weight of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate is 341.4. |
| Q: What is the CAS number of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate? |
| A: CAS number of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate is 2680800-69-3. |
| Q: What is the English name of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate? |
| A: The English name of benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate is benzyl N-(4,6-dimethoxy-3-oxo-2,3-dihydro-1H-inden-1-yl)carbamate. |