benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate
Modify Date: 2026-09-22 18:04:36
![benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate Structure](https://www.chemsrc.com/extcaspic/028/2680816-19-5.png)
benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate structure
|
Common Name | benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2680816-19-5 | Molecular Weight | 402.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H20BrNO3 |
|---|---|
| Molecular Weight | 402.3 |
| InChIKey | MXFSREAXFVGPBG-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1)N1Cc2cc(Br)ccc2OC2(CCC2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate? |
| A: Molecular formula of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate is C20H20BrNO3. |
| Q: What is the InChIKey of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate? |
| A: InChIKey of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate is MXFSREAXFVGPBG-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 2680816-19-5? |
| A: Chinese name of 2680816-19-5 is 2680816-19-5. |
| Q: What is the English name of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate? |
| A: The English name of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate is benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate. |
| Q: What is the molecular weight of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate? |
| A: Molecular weight of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate is 402.3. |
| Q: What is the CAS number of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate? |
| A: CAS number of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate is 2680816-19-5. |
| Q: What is the SMILES notation of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate? |
| A: SMILES notation of benzyl 7-bromo-4,5-dihydro-3H-spiro[1,4-benzoxazepine-2,1'-cyclobutane]-4-carboxylate is O=C(OCc1ccccc1)N1Cc2cc(Br)ccc2OC2(CCC2)C1. |