4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid
Modify Date: 2026-09-28 11:35:21
![4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid Structure](https://www.chemsrc.com/extcaspic/228/2680816-58-2.png)
4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid structure
|
Common Name | 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2680816-58-2 | Molecular Weight | 341.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14F3N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14F3N3O3 |
|---|---|
| Molecular Weight | 341.28 |
| InChIKey | HYSUAWJXOSZLKV-UHFFFAOYSA-N |
| SMILES | CCn1cc(CN(C(=O)C(F)(F)F)c2ccc(C(=O)O)cc2)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid? |
| A: CAS number of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid is 2680816-58-2. |
| Q: What is the molecular weight of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid? |
| A: Molecular weight of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid is 341.28. |
| Q: What is the SMILES notation of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid? |
| A: SMILES notation of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid is CCn1cc(CN(C(=O)C(F)(F)F)c2ccc(C(=O)O)cc2)cn1. |
| Q: What is the molecular formula of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid? |
| A: Molecular formula of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid is C15H14F3N3O3. |
| Q: What is the Chinese name of 2680816-58-2? |
| A: Chinese name of 2680816-58-2 is 2680816-58-2. |
| Q: What is the English name of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid? |
| A: The English name of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid is 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid. |
| Q: What is the InChIKey of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid? |
| A: InChIKey of 4-{N-[(1-ethyl-1H-pyrazol-4-yl)methyl]-2,2,2-trifluoroacetamido}benzoic acid is HYSUAWJXOSZLKV-UHFFFAOYSA-N. |