{2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid
Modify Date: 2025-11-05 12:35:55
![{2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid Structure](https://www.chemsrc.com/extcaspic/044/2680820-89-5.png)
{2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid structure
|
Common Name | {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid | ||
|---|---|---|---|---|
| CAS Number | 2680820-89-5 | Molecular Weight | 251.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO4 |
|---|---|
| Molecular Weight | 251.28 |
| InChIKey | XHXSAKPBSXRLDU-UHFFFAOYSA-N |
| SMILES | CN(C(=O)O)c1ccccc1C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2680820-89-5? |
| A: Chinese name of 2680820-89-5 is 2680820-89-5. |
| Q: What is the InChIKey of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid? |
| A: InChIKey of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid is XHXSAKPBSXRLDU-UHFFFAOYSA-N. |
| Q: What is the molecular formula of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid? |
| A: Molecular formula of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid is C13H17NO4. |
| Q: What is the CAS number of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid? |
| A: CAS number of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid is 2680820-89-5. |
| Q: What is the molecular weight of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid? |
| A: Molecular weight of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid is 251.28. |
| Q: What is the English name of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid? |
| A: The English name of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid is {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid. |
| Q: What is the SMILES notation of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid? |
| A: SMILES notation of {2-[(Tert-butoxy)carbonyl]phenyl}(methyl)carbamic acid is CN(C(=O)O)c1ccccc1C(=O)OC(C)(C)C. |