Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate
Modify Date: 2025-09-06 09:17:21
![Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate Structure](https://www.chemsrc.com/extcaspic/109/2680824-19-3.png)
Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate structure
|
Common Name | Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 2680824-19-3 | Molecular Weight | 340.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H16N2O5 |
|---|---|
| Molecular Weight | 340.3 |
| InChIKey | BCQYLXKYGQLGDN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C#N)c(NC(=O)OCc2ccccc2)cc1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate? |
| A: The English name of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate is Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate. |
| Q: What is the Chinese name of 2680824-19-3? |
| A: Chinese name of 2680824-19-3 is 2680824-19-3. |
| Q: What is the molecular formula of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate? |
| A: Molecular formula of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate is C18H16N2O5. |
| Q: What is the molecular weight of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate? |
| A: Molecular weight of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate is 340.3. |
| Q: What is the SMILES notation of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate? |
| A: SMILES notation of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate is CCOC(=O)c1cc(C#N)c(NC(=O)OCc2ccccc2)cc1O. |
| Q: What is the InChIKey of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate? |
| A: InChIKey of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate is BCQYLXKYGQLGDN-UHFFFAOYSA-N. |
| Q: What is the CAS number of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate? |
| A: CAS number of Ethyl 4-{[(benzyloxy)carbonyl]amino}-5-cyano-2-hydroxybenzoate is 2680824-19-3. |